C17H11F2NO3S2 — CID 121430493
(5Z)-5-[[5-(3,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-oxopropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 121430493) has the molecular formula C17H11F2NO3S2 and a molecular weight of 379.41 g/mol. Its IUPAC name is (5Z)-5-[[5-(3,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-oxopropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-oxopropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 121430493 |
| Molecular Formula | C17H11F2NO3S2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (5Z)-5-[[5-(3,4-difluorophenyl)furan-2-yl]methylidene]-3-(2-oxopropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(=O)CN1C(=O)/C(=C/c2ccc(-c3ccc(F)c(F)c3)o2)SC1=S |
| InChI | InChI=1S/C17H11F2NO3S2/c1-9(21)8-20-16(22)15(25-17(20)24)7-11-3-5-14(23-11)10-2-4-12(18)13(19)6-10/h2-7H,8H2,1H3/b15-7- |
| InChIKey | UDUSTUGOPQRFLI-CHHVJCJISA-N |
| XLogP | 4.01 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|