C20H15NO8S2 — CID 4190166
2-[5-[[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 4190166) has the molecular formula C20H15NO8S2 and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-[5-[[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 4190166 |
| Molecular Formula | C20H15NO8S2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 2-[5-[[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C=C3SC(=S)N(CC(=O)O)C3=O)o2)c1 |
| InChI | InChI=1S/C20H15NO8S2/c1-27-18(25)11-5-10(6-12(7-11)19(26)28-2)14-4-3-13(29-14)8-15-17(24)21(9-16(22)23)20(30)31-15/h3-8H,9H2,1-2H3,(H,22,23) |
| InChIKey | FAKOQTYLYFBMQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|