C26H31NO5S2 — CID 143248383
methyl 4-[5-[(E)-[4-oxo-3-(7-propoxyheptyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 143248383) has the molecular formula C26H31NO5S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is methyl 4-[5-[(E)-[4-oxo-3-(7-propoxyheptyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-[4-oxo-3-(7-propoxyheptyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 143248383 |
| Molecular Formula | C26H31NO5S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | methyl 4-[5-[(E)-[4-oxo-3-(7-propoxyheptyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCOCCCCCCCN1C(=O)/C(=C\c2ccc(-c3ccc(C(=O)OC)cc3)o2)SC1=S |
| InChI | InChI=1S/C26H31NO5S2/c1-3-16-31-17-8-6-4-5-7-15-27-24(28)23(34-26(27)33)18-21-13-14-22(32-21)19-9-11-20(12-10-19)25(29)30-2/h9-14,18H,3-8,15-17H2,1-2H3/b23-18+ |
| InChIKey | WEGFVSDOYIJDLK-PTGBLXJZSA-N |
| XLogP | 6.31 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|