C25H19NO6S2 — CID 4516743
dimethyl 5-[5-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate (PubChem CID 4516743) has the molecular formula C25H19NO6S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is dimethyl 5-[5-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[5-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4516743 |
| Molecular Formula | C25H19NO6S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | dimethyl 5-[5-[(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C=C3SC(=S)N(Cc4ccccc4)C3=O)o2)c1 |
| InChI | InChI=1S/C25H19NO6S2/c1-30-23(28)17-10-16(11-18(12-17)24(29)31-2)20-9-8-19(32-20)13-21-22(27)26(25(33)34-21)14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3 |
| InChIKey | FLNFFSZLJHOYJV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|