C28H20N2O4S2 — CID 16629814
4-[3-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 16629814) has the molecular formula C28H20N2O4S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 16629814 |
| Molecular Formula | C28H20N2O4S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 4-[3-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2c3ccccc3cc3ccccc23)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H20N2O4S2/c31-25(29-20-11-9-17(10-12-20)27(33)34)13-14-30-26(32)24(36-28(30)35)16-23-21-7-3-1-5-18(21)15-19-6-2-4-8-22(19)23/h1-12,15-16H,13-14H2,(H,29,31)(H,33,34)/b24-16- |
| InChIKey | ABKAMUNACRSPAX-JLPGSUDCSA-N |
| XLogP | 5.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|