C25H22N2O4S2 — CID 16630498
3-[4-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid (PubChem CID 16630498) has the molecular formula C25H22N2O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[4-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid.
| Compound Name | 3-[4-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16630498 |
| Molecular Formula | C25H22N2O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 3-[4-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CCCN1C(=O)/C(=C/c2c3ccccc3cc3ccccc23)SC1=S |
| InChI | InChI=1S/C25H22N2O4S2/c28-22(26-12-11-23(29)30)10-5-13-27-24(31)21(33-25(27)32)15-20-18-8-3-1-6-16(18)14-17-7-2-4-9-19(17)20/h1-4,6-9,14-15H,5,10-13H2,(H,26,28)(H,29,30)/b21-15- |
| InChIKey | VCZQEXDAOZXBNY-QNGOZBTKSA-N |
| XLogP | 4.57 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|