C26H24N2O5S — CID 16632358
6-[[2-[(5Z)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid (PubChem CID 16632358) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is 6-[[2-[(5Z)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(5Z)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 16632358 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 6-[[2-[(5Z)-5-(anthracen-9-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN1C(=O)S/C(=C\c2c3ccccc3cc3ccccc23)C1=O |
| InChI | InChI=1S/C26H24N2O5S/c29-23(27-13-7-1-2-12-24(30)31)16-28-25(32)22(34-26(28)33)15-21-19-10-5-3-8-17(19)14-18-9-4-6-11-20(18)21/h3-6,8-11,14-15H,1-2,7,12-13,16H2,(H,27,29)(H,30,31)/b22-15- |
| InChIKey | OVKOGBRQQIYIQW-JCMHNJIXSA-N |
| XLogP | 4.79 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|