C24H24N2O6S — CID 16632340
6-[[2-[(5Z)-2,4-dioxo-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid (PubChem CID 16632340) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 6-[[2-[(5Z)-2,4-dioxo-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(5Z)-2,4-dioxo-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 16632340 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 6-[[2-[(5Z)-2,4-dioxo-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN1C(=O)S/C(=C\c2cccc(Oc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C24H24N2O6S/c27-21(25-13-6-2-5-12-22(28)29)16-26-23(30)20(33-24(26)31)15-17-8-7-11-19(14-17)32-18-9-3-1-4-10-18/h1,3-4,7-11,14-15H,2,5-6,12-13,16H2,(H,25,27)(H,28,29)/b20-15- |
| InChIKey | YEDUFRBCVZUGFI-HKWRFOASSA-N |
| XLogP | 4.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|