C26H17N3O4S2 — CID 16629334
2-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 16629334) has the molecular formula C26H17N3O4S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16629334 |
| Molecular Formula | C26H17N3O4S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 2-[(5Z)-5-(anthracen-9-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2c3ccccc3cc3ccccc23)SC1=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H17N3O4S2/c30-24(27-18-9-11-19(12-10-18)29(32)33)15-28-25(31)23(35-26(28)34)14-22-20-7-3-1-5-16(20)13-17-6-2-4-8-21(17)22/h1-14H,15H2,(H,27,30)/b23-14- |
| InChIKey | SWIRRXVMARWYDO-UCQKPKSFSA-N |
| XLogP | 5.74 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|