C21H15F4NO3S3 — CID 91483915
cis-(1R,3S)-3-[5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclopentane-1-carboxylic acid (PubChem CID 91483915) has the molecular formula C21H15F4NO3S3 and a molecular weight of 501.55 g/mol. Its IUPAC name is cis-(1R,3S)-3-[5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 91483915 |
| Molecular Formula | C21H15F4NO3S3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | cis-(1R,3S)-3-[5-[[4-[4-fluoro-3-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](N2C(=O)C(=Cc3cc(-c4ccc(F)c(C(F)(F)F)c4)cs3)SC2=S)C1 |
| InChI | InChI=1S/C21H15F4NO3S3/c22-16-4-2-10(7-15(16)21(23,24)25)12-6-14(31-9-12)8-17-18(27)26(20(30)32-17)13-3-1-11(5-13)19(28)29/h2,4,6-9,11,13H,1,3,5H2,(H,28,29)/t11-,13+/m1/s1 |
| InChIKey | OYTKWGGPVCSXFK-YPMHNXCESA-N |
| XLogP | 6.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|