C24H22F2N2O4S3 — CID 58643244
3-[[4-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 58643244) has the molecular formula C24H22F2N2O4S3 and a molecular weight of 536.65 g/mol. Its IUPAC name is 3-[[4-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58643244 |
| Molecular Formula | C24H22F2N2O4S3 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 3-[[4-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1CCC(N2C(=O)/C(=C/c3cc(-c4ccc(F)c(F)c4)cs3)SC2=S)CC1 |
| InChI | InChI=1S/C24H22F2N2O4S3/c25-18-6-3-14(10-19(18)26)15-9-17(34-12-15)11-20-23(32)28(24(33)35-20)16-4-1-13(2-5-16)22(31)27-8-7-21(29)30/h3,6,9-13,16H,1-2,4-5,7-8H2,(H,27,31)(H,29,30)/b20-11- |
| InChIKey | YSNWUYWTKOTUFR-JAIQZWGSSA-N |
| XLogP | 5.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|