C21H17F2N3O6S2 — CID 91411542
(3S)-4-amino-3-[3-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]-4-oxobutanoic acid (PubChem CID 91411542) has the molecular formula C21H17F2N3O6S2 and a molecular weight of 509.51 g/mol. Its IUPAC name is (3S)-4-amino-3-[3-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-amino-3-[3-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91411542 |
| Molecular Formula | C21H17F2N3O6S2 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | (3S)-4-amino-3-[3-[5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)[C@H](CC(=O)O)NC(=O)CCN1C(=O)SC(=Cc2cc(-c3ccc(F)c(F)c3)cs2)C1=O |
| InChI | InChI=1S/C21H17F2N3O6S2/c22-13-2-1-10(6-14(13)23)11-5-12(33-9-11)7-16-20(31)26(21(32)34-16)4-3-17(27)25-15(19(24)30)8-18(28)29/h1-2,5-7,9,15H,3-4,8H2,(H2,24,30)(H,25,27)(H,28,29)/t15-/m0/s1 |
| InChIKey | AAPAMTCKXJECTN-HNNXBMFYSA-N |
| XLogP | 2.56 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|