C22H13F2N3O5S4 — CID 58642142
2-[2-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid (PubChem CID 58642142) has the molecular formula C22H13F2N3O5S4 and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-[2-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 58642142 |
| Molecular Formula | C22H13F2N3O5S4 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 564.97 |
| IUPAC Name | 2-[2-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-1,3-thiazol-4-yl]-2-oxoacetic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)Nc1nc(C(=O)C(=O)O)cs1 |
| InChI | InChI=1S/C22H13F2N3O5S4/c23-13-2-1-10(6-14(13)24)11-5-12(34-8-11)7-16-19(30)27(22(33)36-16)4-3-17(28)26-21-25-15(9-35-21)18(29)20(31)32/h1-2,5-9H,3-4H2,(H,31,32)(H,25,26,28)/b16-7- |
| InChIKey | KCCIFTPBWGYCMW-APSNUPSMSA-N |
| XLogP | 4.65 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|