C22H21NO4S3 — CID 24775363
4-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylic acid (PubChem CID 24775363) has the molecular formula C22H21NO4S3 and a molecular weight of 459.61 g/mol. Its IUPAC name is 4-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 24775363 |
| Molecular Formula | C22H21NO4S3 |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 4-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylic acid |
| SMILES | CSc1ccc(-c2ccc(/C=C3/SC(=S)N(C4CCC(C(=O)O)CC4)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H21NO4S3/c1-29-17-9-4-13(5-10-17)18-11-8-16(27-18)12-19-20(24)23(22(28)30-19)15-6-2-14(3-7-15)21(25)26/h4-5,8-12,14-15H,2-3,6-7H2,1H3,(H,25,26)/b19-12+ |
| InChIKey | GMERIQJTZLIDPG-XDHOZWIPSA-N |
| XLogP | 5.51 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|