C28H34N2O6S3 — CID 87469693
2-[bis(2-hydroxyethyl)amino]ethyl 3-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylate (PubChem CID 87469693) has the molecular formula C28H34N2O6S3 and a molecular weight of 590.79 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethyl 3-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylate.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethyl 3-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87469693 |
| Molecular Formula | C28H34N2O6S3 |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethyl 3-[(5E)-5-[[5-(4-methylsulfanylphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]cyclohexane-1-carboxylate |
| SMILES | CSc1ccc(-c2ccc(/C=C3/SC(=S)N(C4CCCC(C(=O)OCCN(CCO)CCO)C4)C3=O)o2)cc1 |
| InChI | InChI=1S/C28H34N2O6S3/c1-38-23-8-5-19(6-9-23)24-10-7-22(36-24)18-25-26(33)30(28(37)39-25)21-4-2-3-20(17-21)27(34)35-16-13-29(11-14-31)12-15-32/h5-10,18,20-21,31-32H,2-4,11-17H2,1H3/b25-18+ |
| InChIKey | PXHFTAMHYJENPE-XIEYBQDHSA-N |
| XLogP | 4.26 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|