C29H26Cl2N2O5S3 — CID 58643597
4-[3-[(5Z)-5-[[4-(2,5-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid (PubChem CID 58643597) has the molecular formula C29H26Cl2N2O5S3 and a molecular weight of 649.64 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-(2,5-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-(2,5-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 58643597 |
| Molecular Formula | C29H26Cl2N2O5S3 |
| Molecular Weight | 649.64 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-(2,5-dichlorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C(=O)/C(=C/c3cc(-c4cc(Cl)ccc4Cl)cs3)SC2=S)c(CN2CCOCC2)c1 |
| InChI | InChI=1S/C29H26Cl2N2O5S3/c30-21-3-4-24(31)23(14-21)20-13-22(40-17-20)15-26-27(34)33(29(39)41-26)6-1-9-38-25-5-2-18(28(35)36)12-19(25)16-32-7-10-37-11-8-32/h2-5,12-15,17H,1,6-11,16H2,(H,35,36)/b26-15- |
| InChIKey | FZBDDCOKVQYHKS-YSMPRRRNSA-N |
| XLogP | 6.92 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|