C34H34Cl2N2O6S2 — CID 58643478
2-[3-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]phenyl]acetic acid (PubChem CID 58643478) has the molecular formula C34H34Cl2N2O6S2 and a molecular weight of 701.69 g/mol. Its IUPAC name is 2-[3-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 58643478 |
| Molecular Formula | C34H34Cl2N2O6S2 |
| Molecular Weight | 701.69 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | 2-[3-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(3-morpholin-4-ylpropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCCN2C(=O)/C(=C/c3cc(-c4ccc(Cl)cc4Cl)ccc3OCCCN3CCOCC3)SC2=S)c1 |
| InChI | InChI=1S/C34H34Cl2N2O6S2/c35-26-7-8-28(29(36)22-26)24-6-9-30(44-15-2-10-37-12-16-42-17-13-37)25(20-24)21-31-33(41)38(34(45)46-31)11-3-14-43-27-5-1-4-23(18-27)19-32(39)40/h1,4-9,18,20-22H,2-3,10-17,19H2,(H,39,40)/b31-21- |
| InChIKey | KVNHXRWODQFZER-YQYKVWLJSA-N |
| XLogP | 7.06 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|