C29H31F3N2O5S2 — CID 58643756
6-[(5Z)-5-[[2-(2-morpholin-4-ylethoxy)-5-[3-(trifluoromethyl)phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58643756) has the molecular formula C29H31F3N2O5S2 and a molecular weight of 608.70 g/mol. Its IUPAC name is 6-[(5Z)-5-[[2-(2-morpholin-4-ylethoxy)-5-[3-(trifluoromethyl)phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[2-(2-morpholin-4-ylethoxy)-5-[3-(trifluoromethyl)phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58643756 |
| Molecular Formula | C29H31F3N2O5S2 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 6-[(5Z)-5-[[2-(2-morpholin-4-ylethoxy)-5-[3-(trifluoromethyl)phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2cc(-c3cccc(C(F)(F)F)c3)ccc2OCCN2CCOCC2)SC1=S |
| InChI | InChI=1S/C29H31F3N2O5S2/c30-29(31,32)23-6-4-5-20(18-23)21-8-9-24(39-16-13-33-11-14-38-15-12-33)22(17-21)19-25-27(37)34(28(40)41-25)10-3-1-2-7-26(35)36/h4-6,8-9,17-19H,1-3,7,10-16H2,(H,35,36)/b25-19- |
| InChIKey | NQMUYTGQQFSOFX-PLRJNAJWSA-N |
| XLogP | 5.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|