C33H32Cl2N2O7S2 — CID 58642437
4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid (PubChem CID 58642437) has the molecular formula C33H32Cl2N2O7S2 and a molecular weight of 703.67 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58642437 |
| Molecular Formula | C33H32Cl2N2O7S2 |
| Molecular Weight | 703.67 g/mol |
| Exact Mass | 702.10 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCN1C(=O)/C(=C/c2cc(-c3ccc(Cl)cc3Cl)ccc2OCCN2CCOCC2)SC1=S |
| InChI | InChI=1S/C33H32Cl2N2O7S2/c1-41-29-18-22(32(39)40)4-8-28(29)43-13-2-9-37-31(38)30(46-33(37)45)19-23-17-21(25-6-5-24(34)20-26(25)35)3-7-27(23)44-16-12-36-10-14-42-15-11-36/h3-8,17-20H,2,9-16H2,1H3,(H,39,40)/b30-19- |
| InChIKey | CPFLOTDOKCVPRW-FSGOGVSDSA-N |
| XLogP | 6.75 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|