C37H36N2O7S2 — CID 58642741
4-[3-[(5Z)-5-[[5-(6-hydroxynaphthalen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid (PubChem CID 58642741) has the molecular formula C37H36N2O7S2 and a molecular weight of 684.84 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(6-hydroxynaphthalen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(6-hydroxynaphthalen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58642741 |
| Molecular Formula | C37H36N2O7S2 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(6-hydroxynaphthalen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCN1C(=O)/C(=C/c2cc(-c3ccc4cc(O)ccc4c3)ccc2OCCN2CCCC2)SC1=S |
| InChI | InChI=1S/C37H36N2O7S2/c1-44-33-22-28(36(42)43)9-12-32(33)45-17-4-15-39-35(41)34(48-37(39)47)23-29-20-26(8-11-31(29)46-18-16-38-13-2-3-14-38)24-5-6-27-21-30(40)10-7-25(27)19-24/h5-12,19-23,40H,2-4,13-18H2,1H3,(H,42,43)/b34-23- |
| InChIKey | OZPJSPPMNUUDQN-XSVYLIDLSA-N |
| XLogP | 7.06 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|