C29H25N3O6S2 — CID 58644551
4-[3-[(5Z)-5-[[3-(1H-indazol-5-yl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid (PubChem CID 58644551) has the molecular formula C29H25N3O6S2 and a molecular weight of 575.67 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-(1H-indazol-5-yl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-(1H-indazol-5-yl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58644551 |
| Molecular Formula | C29H25N3O6S2 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-(1H-indazol-5-yl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCN1C(=O)/C(=C/c2ccc(OC)c(-c3ccc4[nH]ncc4c3)c2)SC1=S |
| InChI | InChI=1S/C29H25N3O6S2/c1-36-23-8-4-17(12-21(23)18-5-7-22-20(14-18)16-30-31-22)13-26-27(33)32(29(39)40-26)10-3-11-38-24-9-6-19(28(34)35)15-25(24)37-2/h4-9,12-16H,3,10-11H2,1-2H3,(H,30,31)(H,34,35)/b26-13- |
| InChIKey | NNVZVWXFBOXTJG-ZMFRSBBQSA-N |
| XLogP | 5.62 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|