C34H33N3O5S2 — CID 58642240
4-[2-[(5Z)-5-[[3-(2-methyl-1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58642240) has the molecular formula C34H33N3O5S2 and a molecular weight of 627.79 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[3-(2-methyl-1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[3-(2-methyl-1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58642240 |
| Molecular Formula | C34H33N3O5S2 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | 4-[2-[(5Z)-5-[[3-(2-methyl-1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | Cc1cc2cc(-c3cc(/C=C4\SC(=S)N(CCc5ccc(C(=O)O)cc5)C4=O)ccc3OCCN3CCOCC3)ccc2[nH]1 |
| InChI | InChI=1S/C34H33N3O5S2/c1-22-18-27-21-26(7-8-29(27)35-22)28-19-24(4-9-30(28)42-17-14-36-12-15-41-16-13-36)20-31-32(38)37(34(43)44-31)11-10-23-2-5-25(6-3-23)33(39)40/h2-9,18-21,35H,10-17H2,1H3,(H,39,40)/b31-20- |
| InChIKey | FHMXPNBXBWBFCP-GTWSWNCMSA-N |
| XLogP | 6.00 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|