C32H31ClN2O6S2 — CID 58642198
4-[2-[(5Z)-5-[[3-(3-chloro-5-methoxyphenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58642198) has the molecular formula C32H31ClN2O6S2 and a molecular weight of 639.20 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[3-(3-chloro-5-methoxyphenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[3-(3-chloro-5-methoxyphenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58642198 |
| Molecular Formula | C32H31ClN2O6S2 |
| Molecular Weight | 639.20 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | 4-[2-[(5Z)-5-[[3-(3-chloro-5-methoxyphenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | COc1cc(Cl)cc(-c2cc(/C=C3\SC(=S)N(CCc4ccc(C(=O)O)cc4)C3=O)ccc2OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C32H31ClN2O6S2/c1-39-26-19-24(18-25(33)20-26)27-16-22(4-7-28(27)41-15-12-34-10-13-40-14-11-34)17-29-30(36)35(32(42)43-29)9-8-21-2-5-23(6-3-21)31(37)38/h2-7,16-20H,8-15H2,1H3,(H,37,38)/b29-17- |
| InChIKey | KASJEPKGZWKHEF-RHANQZHGSA-N |
| XLogP | 5.87 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.20 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|