C35H31F6N3O7S2 — CID 58643096
4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid (PubChem CID 58643096) has the molecular formula C35H31F6N3O7S2 and a molecular weight of 783.77 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58643096 |
| Molecular Formula | C35H31F6N3O7S2 |
| Molecular Weight | 783.77 g/mol |
| Exact Mass | 783.15 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)CCN1C(=O)/C(=C/c2ccc(OCCN3CCOCC3)c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)SC1=S |
| InChI | InChI=1S/C35H31F6N3O7S2/c1-49-28-18-21(32(47)48)3-4-26(28)42-30(45)6-7-44-31(46)29(53-33(44)52)15-20-2-5-27(51-13-10-43-8-11-50-12-9-43)25(14-20)22-16-23(34(36,37)38)19-24(17-22)35(39,40)41/h2-5,14-19H,6-13H2,1H3,(H,42,45)(H,47,48)/b29-15- |
| InChIKey | QNYYYFUXLBXDJB-FDVSRXAVSA-N |
| XLogP | 7.04 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.77 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|