C35H29F6N3O5S2 — CID 58644379
4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58644379) has the molecular formula C35H29F6N3O5S2 and a molecular weight of 749.75 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58644379 |
| Molecular Formula | C35H29F6N3O5S2 |
| Molecular Weight | 749.75 g/mol |
| Exact Mass | 749.15 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(/C=C/CN3CCOCC3)cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H29F6N3O5S2/c36-34(37,38)26-18-25(19-27(20-26)35(39,40)41)24-15-21(2-1-8-43-10-12-49-13-11-43)14-22(16-24)17-29-31(46)44(33(50)51-29)9-7-30(45)42-28-5-3-23(4-6-28)32(47)48/h1-6,14-20H,7-13H2,(H,42,45)(H,47,48)/b2-1+,29-17- |
| InChIKey | PIFWUPLYEOXGNN-CKVJSLNTSA-N |
| XLogP | 7.66 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.75 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|