C33H29Cl2N3O5S2 — CID 58643914
4-[3-[(5Z)-5-[[3-(3,4-dichlorophenyl)-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58643914) has the molecular formula C33H29Cl2N3O5S2 and a molecular weight of 682.65 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-(3,4-dichlorophenyl)-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-(3,4-dichlorophenyl)-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58643914 |
| Molecular Formula | C33H29Cl2N3O5S2 |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 681.09 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-(3,4-dichlorophenyl)-5-[(E)-3-morpholin-4-ylprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(/C=C/CN3CCOCC3)cc(-c3ccc(Cl)c(Cl)c3)c2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H29Cl2N3O5S2/c34-27-8-5-24(20-28(27)35)25-17-21(2-1-10-37-12-14-43-15-13-37)16-22(18-25)19-29-31(40)38(33(44)45-29)11-9-30(39)36-26-6-3-23(4-7-26)32(41)42/h1-8,16-20H,9-15H2,(H,36,39)(H,41,42)/b2-1+,29-19- |
| InChIKey | HWFKMCISCAKFLW-LVZZMVBASA-N |
| XLogP | 6.93 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|