C31H29Cl2N3O4S2 — CID 58644705
3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylpropanamide (PubChem CID 58644705) has the molecular formula C31H29Cl2N3O4S2 and a molecular weight of 642.63 g/mol. Its IUPAC name is 3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylpropanamide.
| Compound Name | 3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 58644705 |
| Molecular Formula | C31H29Cl2N3O4S2 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | 3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylpropanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(Cl)cc3Cl)ccc2OCCN2CCOCC2)SC1=S)Nc1ccccc1 |
| InChI | InChI=1S/C31H29Cl2N3O4S2/c32-23-7-8-25(26(33)20-23)21-6-9-27(40-17-14-35-12-15-39-16-13-35)22(18-21)19-28-30(38)36(31(41)42-28)11-10-29(37)34-24-4-2-1-3-5-24/h1-9,18-20H,10-17H2,(H,34,37)/b28-19- |
| InChIKey | NAAWJWZRSHOJMR-USHMODERSA-N |
| XLogP | 6.60 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|