C32H35Cl2N3O6S2 — CID 58643833
4-[3-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 58643833) has the molecular formula C32H35Cl2N3O6S2 and a molecular weight of 692.69 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58643833 |
| Molecular Formula | C32H35Cl2N3O6S2 |
| Molecular Weight | 692.69 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3cc(Cl)cc(Cl)c3)ccc2OCCN2CCOCC2)SC1=S)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C32H35Cl2N3O6S2/c33-24-16-22(17-25(34)19-24)21-3-6-27(43-14-11-36-9-12-42-13-10-36)23(15-21)18-28-30(39)37(32(44)45-28)8-7-29(38)35-26-4-1-20(2-5-26)31(40)41/h3,6,15-20,26H,1-2,4-5,7-14H2,(H,35,38)(H,40,41)/b28-18- |
| InChIKey | RLTWHXMXCZSQIC-VEILYXNESA-N |
| XLogP | 5.72 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|