C34H32N4O6S2 — CID 58642640
4-[3-[(5Z)-5-[[5-(1H-indol-6-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58642640) has the molecular formula C34H32N4O6S2 and a molecular weight of 656.79 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(1H-indol-6-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(1H-indol-6-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58642640 |
| Molecular Formula | C34H32N4O6S2 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(1H-indol-6-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc4cc[nH]c4c3)ccc2OCCN2CCOCC2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H32N4O6S2/c39-31(36-27-6-3-23(4-7-27)33(41)42)10-12-38-32(40)30(46-34(38)45)21-26-19-24(25-2-1-22-9-11-35-28(22)20-25)5-8-29(26)44-18-15-37-13-16-43-17-14-37/h1-9,11,19-21,35H,10,12-18H2,(H,36,39)(H,41,42)/b30-21- |
| InChIKey | BZOBSMRJGOSAND-OFWBYEQRSA-N |
| XLogP | 5.47 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|