C33H29F4N3O6S2 — CID 58643003
4-[3-[(5Z)-5-[[5-[2-fluoro-4-(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58643003) has the molecular formula C33H29F4N3O6S2 and a molecular weight of 703.74 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-[2-fluoro-4-(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-[2-fluoro-4-(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58643003 |
| Molecular Formula | C33H29F4N3O6S2 |
| Molecular Weight | 703.74 g/mol |
| Exact Mass | 703.14 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-[2-fluoro-4-(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(C(F)(F)F)cc3F)ccc2OCCN2CCOCC2)SC1=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H29F4N3O6S2/c34-26-19-23(33(35,36)37)4-7-25(26)21-3-8-27(46-16-13-39-11-14-45-15-12-39)22(17-21)18-28-30(42)40(32(47)48-28)10-9-29(41)38-24-5-1-20(2-6-24)31(43)44/h1-8,17-19H,9-16H2,(H,38,41)(H,43,44)/b28-18- |
| InChIKey | ZMWOYTCNPGJTMO-VEILYXNESA-N |
| XLogP | 6.15 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|