C34H29F6N3O7S — CID 87924213
4-[3-[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 87924213) has the molecular formula C34H29F6N3O7S and a molecular weight of 737.68 g/mol. Its IUPAC name is 4-[3-[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 87924213 |
| Molecular Formula | C34H29F6N3O7S |
| Molecular Weight | 737.68 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | 4-[3-[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | O=C(CCN1C(=O)SC(=Cc2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2OCCN2CCOCC2)C1=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H29F6N3O7S/c35-33(36,37)24-16-22(17-25(19-24)34(38,39)40)21-3-6-27(50-14-11-42-9-12-49-13-10-42)23(15-21)18-28-30(45)43(32(48)51-28)8-7-29(44)41-26-4-1-20(2-5-26)31(46)47/h1-6,15-19H,7-14H2,(H,41,44)(H,46,47) |
| InChIKey | UEGFINXWJNJCTG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|