C34H30F6N2O8S2 — CID 91512923
4-[(2R)-3-[[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxy]-2-hydroxypropoxy]benzoic acid (PubChem CID 91512923) has the molecular formula C34H30F6N2O8S2 and a molecular weight of 772.74 g/mol. Its IUPAC name is 4-[(2R)-3-[[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxy]-2-hydroxypropoxy]benzoic acid.
| Compound Name | 4-[(2R)-3-[[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxy]-2-hydroxypropoxy]benzoic acid |
|---|---|
| PubChem CID | 91512923 |
| Molecular Formula | C34H30F6N2O8S2 |
| Molecular Weight | 772.74 g/mol |
| Exact Mass | 772.13 |
| IUPAC Name | 4-[(2R)-3-[[5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxy]-2-hydroxypropoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OC[C@@H](O)CON2C(=O)C(=Cc3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc3OCCN3CCOCC3)SC2=S)cc1 |
| InChI | InChI=1S/C34H30F6N2O8S2/c35-33(36,37)24-14-22(15-25(17-24)34(38,39)40)21-3-6-28(48-12-9-41-7-10-47-11-8-41)23(13-21)16-29-30(44)42(32(51)52-29)50-19-26(43)18-49-27-4-1-20(2-5-27)31(45)46/h1-6,13-17,26,43H,7-12,18-19H2,(H,45,46)/t26-/m1/s1 |
| InChIKey | WYWUXSSNYSOZAW-AREMUKBSSA-N |
| XLogP | 6.37 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|