C28H30Cl2N2O5S2 — CID 58642072
6-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58642072) has the molecular formula C28H30Cl2N2O5S2 and a molecular weight of 609.60 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58642072 |
| Molecular Formula | C28H30Cl2N2O5S2 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | 6-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2cc(-c3cc(Cl)cc(Cl)c3)ccc2OCCN2CCOCC2)SC1=S |
| InChI | InChI=1S/C28H30Cl2N2O5S2/c29-22-15-20(16-23(30)18-22)19-5-6-24(37-13-10-31-8-11-36-12-9-31)21(14-19)17-25-27(35)32(28(38)39-25)7-3-1-2-4-26(33)34/h5-6,14-18H,1-4,7-13H2,(H,33,34)/b25-17- |
| InChIKey | IJJWVECDLQUKGY-UQQQWYQISA-N |
| XLogP | 6.22 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|