C31H28Cl2N2O4S2 — CID 58642494
4-[2-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58642494) has the molecular formula C31H28Cl2N2O4S2 and a molecular weight of 627.62 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58642494 |
| Molecular Formula | C31H28Cl2N2O4S2 |
| Molecular Weight | 627.62 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | 4-[2-[(5Z)-5-[[5-(3,5-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)/C(=C/c3cc(-c4cc(Cl)cc(Cl)c4)ccc3OCCN3CCCC3)SC2=S)cc1 |
| InChI | InChI=1S/C31H28Cl2N2O4S2/c32-25-16-23(17-26(33)19-25)22-7-8-27(39-14-13-34-10-1-2-11-34)24(15-22)18-28-29(36)35(31(40)41-28)12-9-20-3-5-21(6-4-20)30(37)38/h3-8,15-19H,1-2,9-14H2,(H,37,38)/b28-18- |
| InChIKey | DRXYXZMXWLVYMP-VEILYXNESA-N |
| XLogP | 7.28 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|