C29H26Cl2N2O4S2 — CID 58643905
4-[2-[(5Z)-5-[[5-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58643905) has the molecular formula C29H26Cl2N2O4S2 and a molecular weight of 601.58 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[5-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[5-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58643905 |
| Molecular Formula | C29H26Cl2N2O4S2 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | 4-[2-[(5Z)-5-[[5-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | CN(C)CCOc1ccc(-c2ccc(Cl)c(Cl)c2)cc1/C=C1\SC(=S)N(CCc2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C29H26Cl2N2O4S2/c1-32(2)13-14-37-25-10-8-20(21-7-9-23(30)24(31)16-21)15-22(25)17-26-27(34)33(29(38)39-26)12-11-18-3-5-19(6-4-18)28(35)36/h3-10,15-17H,11-14H2,1-2H3,(H,35,36)/b26-17- |
| InChIKey | OBRXESYYBBTQBA-ONUIUJJFSA-N |
| XLogP | 6.74 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|