C33H30F6N2O6S2 — CID 58643035
4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid (PubChem CID 58643035) has the molecular formula C33H30F6N2O6S2 and a molecular weight of 728.73 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58643035 |
| Molecular Formula | C33H30F6N2O6S2 |
| Molecular Weight | 728.73 g/mol |
| Exact Mass | 728.14 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCN1C(=O)/C(=C/c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2OCCN(C)C)SC1=S |
| InChI | InChI=1S/C33H30F6N2O6S2/c1-40(2)10-12-47-25-7-5-19(21-14-23(32(34,35)36)18-24(15-21)33(37,38)39)13-22(25)17-28-29(42)41(31(48)49-28)9-4-11-46-26-8-6-20(30(43)44)16-27(26)45-3/h5-8,13-18H,4,9-12H2,1-3H3,(H,43,44)/b28-17- |
| InChIKey | CJBBKTUZOZRTPV-QRQIAZFYSA-N |
| XLogP | 7.71 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.73 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|