C24H24F2N6O2S2 — CID 58643105
(5Z)-5-[[5-(3,4-difluorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one (PubChem CID 58643105) has the molecular formula C24H24F2N6O2S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is (5Z)-5-[[5-(3,4-difluorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3,4-difluorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643105 |
| Molecular Formula | C24H24F2N6O2S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (5Z)-5-[[5-(3,4-difluorophenyl)-2-[2-(dimethylamino)ethoxy]phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)CCOc1ccc(-c2ccc(F)c(F)c2)cc1/C=C1\SC(=S)N(CCCc2nn[nH]n2)C1=O |
| InChI | InChI=1S/C24H24F2N6O2S2/c1-31(2)10-11-34-20-8-6-15(16-5-7-18(25)19(26)13-16)12-17(20)14-21-23(33)32(24(35)36-21)9-3-4-22-27-29-30-28-22/h5-8,12-14H,3-4,9-11H2,1-2H3,(H,27,28,29,30)/b21-14- |
| InChIKey | WKMVDECASQRURW-STZFKDTASA-N |
| XLogP | 3.92 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|