C22H20N6OS3 — CID 58644727
(5Z)-5-[[4-(1H-indol-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one (PubChem CID 58644727) has the molecular formula C22H20N6OS3 and a molecular weight of 480.64 g/mol. Its IUPAC name is (5Z)-5-[[4-(1H-indol-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(1H-indol-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58644727 |
| Molecular Formula | C22H20N6OS3 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (5Z)-5-[[4-(1H-indol-5-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(-c3ccc4[nH]ccc4c3)cs2)SC(=S)N1CCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C22H20N6OS3/c29-21-19(32-22(30)28(21)9-3-1-2-4-20-24-26-27-25-20)12-17-11-16(13-31-17)14-5-6-18-15(10-14)7-8-23-18/h5-8,10-13,23H,1-4,9H2,(H,24,25,26,27)/b19-12- |
| InChIKey | DBKUVBRLGMFWDI-UNOMPAQXSA-N |
| XLogP | 5.02 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|