C29H31N7O3S2 — CID 58642091
(5Z)-5-[[5-(1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one (PubChem CID 58642091) has the molecular formula C29H31N7O3S2 and a molecular weight of 589.75 g/mol. Its IUPAC name is (5Z)-5-[[5-(1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58642091 |
| Molecular Formula | C29H31N7O3S2 |
| Molecular Weight | 589.75 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | (5Z)-5-[[5-(1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(-c3ccc4[nH]ccc4c3)ccc2OCCN2CCOCC2)SC(=S)N1CCCCc1nn[nH]n1 |
| InChI | InChI=1S/C29H31N7O3S2/c37-28-26(41-29(40)36(28)10-2-1-3-27-31-33-34-32-27)19-23-18-21(20-4-6-24-22(17-20)8-9-30-24)5-7-25(23)39-16-13-35-11-14-38-15-12-35/h4-9,17-19,30H,1-3,10-16H2,(H,31,32,33,34)/b26-19- |
| InChIKey | OTIKREHKWJWPJX-XHPQRKPJSA-N |
| XLogP | 4.28 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.75 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|