C29H33N7O3S2 — CID 58643962
(5Z)-5-[[5-(2,3-dihydro-1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one (PubChem CID 58643962) has the molecular formula C29H33N7O3S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dihydro-1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,3-dihydro-1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643962 |
| Molecular Formula | C29H33N7O3S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dihydro-1H-indol-5-yl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[4-(2H-tetrazol-5-yl)butyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(-c3ccc4c(c3)CCN4)ccc2OCCN2CCOCC2)SC(=S)N1CCCCc1nn[nH]n1 |
| InChI | InChI=1S/C29H33N7O3S2/c37-28-26(41-29(40)36(28)10-2-1-3-27-31-33-34-32-27)19-23-18-21(20-4-6-24-22(17-20)8-9-30-24)5-7-25(23)39-16-13-35-11-14-38-15-12-35/h4-7,17-19,30H,1-3,8-16H2,(H,31,32,33,34)/b26-19- |
| InChIKey | PPGPMSLBUMUGHB-XHPQRKPJSA-N |
| XLogP | 3.77 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|