C33H28F6N2O5S2 — CID 58642542
4-[2-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58642542) has the molecular formula C33H28F6N2O5S2 and a molecular weight of 710.72 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58642542 |
| Molecular Formula | C33H28F6N2O5S2 |
| Molecular Weight | 710.72 g/mol |
| Exact Mass | 710.13 |
| IUPAC Name | 4-[2-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)/C(=C/c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc3OCCN3CCOCC3)SC2=S)cc1 |
| InChI | InChI=1S/C33H28F6N2O5S2/c34-32(35,36)25-16-23(17-26(19-25)33(37,38)39)22-5-6-27(46-14-11-40-9-12-45-13-10-40)24(15-22)18-28-29(42)41(31(47)48-28)8-7-20-1-3-21(4-2-20)30(43)44/h1-6,15-19H,7-14H2,(H,43,44)/b28-18- |
| InChIKey | MYPGBRHDGOOTPS-VEILYXNESA-N |
| XLogP | 7.24 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|