C30H26Cl2N2O5S2 — CID 58642030
4-[[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 58642030) has the molecular formula C30H26Cl2N2O5S2 and a molecular weight of 629.59 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 58642030 |
| Molecular Formula | C30H26Cl2N2O5S2 |
| Molecular Weight | 629.59 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | 4-[[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)/C(=C/c3cc(-c4ccc(Cl)cc4Cl)ccc3OCCN3CCOCC3)SC2=S)cc1 |
| InChI | InChI=1S/C30H26Cl2N2O5S2/c31-23-6-7-24(25(32)17-23)21-5-8-26(39-14-11-33-9-12-38-13-10-33)22(15-21)16-27-28(35)34(30(40)41-27)18-19-1-3-20(4-2-19)29(36)37/h1-8,15-17H,9-14,18H2,(H,36,37)/b27-16- |
| InChIKey | XNFHXSHNXBBODO-YUMHPJSZSA-N |
| XLogP | 6.47 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|