C32H30Cl2N2O5S2 — CID 58644137
4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid (PubChem CID 58644137) has the molecular formula C32H30Cl2N2O5S2 and a molecular weight of 657.64 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 58644137 |
| Molecular Formula | C32H30Cl2N2O5S2 |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(2,4-dichlorophenyl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C(=O)/C(=C/c3cc(-c4ccc(Cl)cc4Cl)ccc3OCCN3CCCC3)SC2=S)cc1 |
| InChI | InChI=1S/C32H30Cl2N2O5S2/c33-24-7-10-26(27(34)20-24)22-6-11-28(41-17-15-35-12-1-2-13-35)23(18-22)19-29-30(37)36(32(42)43-29)14-3-16-40-25-8-4-21(5-9-25)31(38)39/h4-11,18-20H,1-3,12-17H2,(H,38,39)/b29-19- |
| InChIKey | WFIWYSAGYFTHSJ-CEUNXORHSA-N |
| XLogP | 7.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|