C34H30F6N2O6S2 — CID 58643967
4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid (PubChem CID 58643967) has the molecular formula C34H30F6N2O6S2 and a molecular weight of 740.74 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 58643967 |
| Molecular Formula | C34H30F6N2O6S2 |
| Molecular Weight | 740.74 g/mol |
| Exact Mass | 740.14 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C(=O)/C(=C/c3ccc(OCCN4CCOCC4)c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3)SC2=S)cc1 |
| InChI | InChI=1S/C34H30F6N2O6S2/c35-33(36,37)24-18-23(19-25(20-24)34(38,39)40)27-16-21(2-7-28(27)48-15-11-41-9-13-46-14-10-41)17-29-30(43)42(32(49)50-29)8-1-12-47-26-5-3-22(4-6-26)31(44)45/h2-7,16-20H,1,8-15H2,(H,44,45)/b29-17- |
| InChIKey | KXXKSIDRJYOMJK-RHANQZHGSA-N |
| XLogP | 7.47 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.74 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|