C34H35ClN2O6S2 — CID 58643218
4-[2-[(5Z)-5-[[5-(3-chloro-4-propoxyphenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid (PubChem CID 58643218) has the molecular formula C34H35ClN2O6S2 and a molecular weight of 667.25 g/mol. Its IUPAC name is 4-[2-[(5Z)-5-[[5-(3-chloro-4-propoxyphenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(5Z)-5-[[5-(3-chloro-4-propoxyphenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 58643218 |
| Molecular Formula | C34H35ClN2O6S2 |
| Molecular Weight | 667.25 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | 4-[2-[(5Z)-5-[[5-(3-chloro-4-propoxyphenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]benzoic acid |
| SMILES | CCCOc1ccc(-c2ccc(OCCN3CCOCC3)c(/C=C3\SC(=S)N(CCc4ccc(C(=O)O)cc4)C3=O)c2)cc1Cl |
| InChI | InChI=1S/C34H35ClN2O6S2/c1-2-16-42-30-10-8-26(21-28(30)35)25-7-9-29(43-19-15-36-13-17-41-18-14-36)27(20-25)22-31-32(38)37(34(44)45-31)12-11-23-3-5-24(6-4-23)33(39)40/h3-10,20-22H,2,11-19H2,1H3,(H,39,40)/b31-22- |
| InChIKey | PYQULMYTIHNULD-VAMRJTSQSA-N |
| XLogP | 6.65 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.25 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|