C28H29N7O3S2 — CID 58643377
(5Z)-5-[[3-(1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one (PubChem CID 58643377) has the molecular formula C28H29N7O3S2 and a molecular weight of 575.72 g/mol. Its IUPAC name is (5Z)-5-[[3-(1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643377 |
| Molecular Formula | C28H29N7O3S2 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | (5Z)-5-[[3-(1H-indol-5-yl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylidene-3-[3-(2H-tetrazol-5-yl)propyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(OCCN3CCOCC3)c(-c3ccc4[nH]ccc4c3)c2)SC(=S)N1CCCc1nn[nH]n1 |
| InChI | InChI=1S/C28H29N7O3S2/c36-27-25(40-28(39)35(27)9-1-2-26-30-32-33-31-26)17-19-3-6-24(38-15-12-34-10-13-37-14-11-34)22(16-19)20-4-5-23-21(18-20)7-8-29-23/h3-8,16-18,29H,1-2,9-15H2,(H,30,31,32,33)/b25-17- |
| InChIKey | MENGYRPPQMJCBU-UQQQWYQISA-N |
| XLogP | 3.89 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|