C22H17F6N5OS3 — CID 58644732
(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one (PubChem CID 58644732) has the molecular formula C22H17F6N5OS3 and a molecular weight of 577.60 g/mol. Its IUPAC name is (5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58644732 |
| Molecular Formula | C22H17F6N5OS3 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | (5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)SC(=S)N1CCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C22H17F6N5OS3/c23-21(24,25)14-6-12(7-15(9-14)22(26,27)28)13-8-16(36-11-13)10-17-19(34)33(20(35)37-17)5-3-1-2-4-18-29-31-32-30-18/h6-11H,1-5H2,(H,29,30,31,32)/b17-10- |
| InChIKey | XIOCGKYWYOKXAI-YVLHZVERSA-N |
| XLogP | 6.58 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|