C24H20F6N6O2S2 — CID 58642413
(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-3-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-4-yl]-1,3-thiazolidin-4-one (PubChem CID 58642413) has the molecular formula C24H20F6N6O2S2 and a molecular weight of 602.59 g/mol. Its IUPAC name is (5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-3-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-4-yl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-3-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-4-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58642413 |
| Molecular Formula | C24H20F6N6O2S2 |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | (5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-3-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-4-yl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)o2)SC(=S)N1C1CCN(CCc2nn[nH]n2)CC1 |
| InChI | InChI=1S/C24H20F6N6O2S2/c25-23(26,27)14-9-13(10-15(11-14)24(28,29)30)18-2-1-17(38-18)12-19-21(37)36(22(39)40-19)16-3-6-35(7-4-16)8-5-20-31-33-34-32-20/h1-2,9-12,16H,3-8H2,(H,31,32,33,34)/b19-12- |
| InChIKey | VGLACBFLLGDMCN-UNOMPAQXSA-N |
| XLogP | 5.41 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|