C25H22F6N2O4S2 — CID 58643022
3-[4-[[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]piperidin-1-yl]propanoic acid (PubChem CID 58643022) has the molecular formula C25H22F6N2O4S2 and a molecular weight of 592.58 g/mol. Its IUPAC name is 3-[4-[[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]piperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-[[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58643022 |
| Molecular Formula | C25H22F6N2O4S2 |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | 3-[4-[[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl]piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC(CN2C(=O)/C(=C/c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)o3)SC2=S)CC1 |
| InChI | InChI=1S/C25H22F6N2O4S2/c26-24(27,28)16-9-15(10-17(11-16)25(29,30)31)19-2-1-18(37-19)12-20-22(36)33(23(38)39-20)13-14-3-6-32(7-4-14)8-5-21(34)35/h1-2,9-12,14H,3-8,13H2,(H,34,35)/b20-12- |
| InChIKey | UJWNNPNZXKRFII-NDENLUEZSA-N |
| XLogP | 6.37 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|