C24H20F6N2O4S2 — CID 58643234
3-[4-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]piperidin-1-yl]propanoic acid (PubChem CID 58643234) has the molecular formula C24H20F6N2O4S2 and a molecular weight of 578.56 g/mol. Its IUPAC name is 3-[4-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]piperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58643234 |
| Molecular Formula | C24H20F6N2O4S2 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 3-[4-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC(N2C(=O)/C(=C/c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)o3)SC2=S)CC1 |
| InChI | InChI=1S/C24H20F6N2O4S2/c25-23(26,27)14-9-13(10-15(11-14)24(28,29)30)18-2-1-17(36-18)12-19-21(35)32(22(37)38-19)16-3-6-31(7-4-16)8-5-20(33)34/h1-2,9-12,16H,3-8H2,(H,33,34)/b19-12- |
| InChIKey | MLVVHGXNLLEKKV-UNOMPAQXSA-N |
| XLogP | 6.12 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|